Products 2923519-78-0
CAS 2923519-78-0 is the registry number for Antifungal agent 73. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]chromen-2-one (CAS 2923519-78-0) is a chemical compound with the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.3 g/mol. IUPAC name: 7-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]chromen-2-one. InChIKey: VKWSRUWNMWEHHA-UHFFFAOYSA-N.
| Molecular formula | C21H16Cl2N2O3 |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | 7-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]chromen-2-one |
| InChIKey | VKWSRUWNMWEHHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)COC(CN3C=CN=C3)C4=C(C=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 73, orb1944265