Products 2923671-26-3
CAS 2923671-26-3 is the registry number for (1R,3R,5R)-3-Ethynyl-2-azabicyclo[3.1.0]hexane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3R,5R)-3-ethynyl-2-azabicyclo[3.1.0]hexane;hydrochloride (CAS 2923671-26-3) is a chemical compound with the molecular formula C7H10ClN and a molecular weight of 143.61 g/mol. IUPAC name: (1R,3R,5R)-3-ethynyl-2-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: RUIVPCBZKDCPQF-LBZPYWGZSA-N.
| Molecular formula | C7H10ClN |
|---|---|
| Molecular weight | 143.61 g/mol |
| IUPAC name | (1R,3R,5R)-3-ethynyl-2-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | RUIVPCBZKDCPQF-LBZPYWGZSA-N |
| SMILES | C#C[C@H]1C[C@H]2C[C@H]2N1.Cl |
Computed by PubChem (NCBI)