CAS 2923687-90-3 appears in our catalog under these names: AZD–9574–acid, AZD-9574-acid, 99.44%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 100 mg, 50 mg, 10 mg, 25 mg.
6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid (CAS 2923687-90-3) is a chemical compound with the molecular formula C20H19F2N5O3 and a molecular weight of 415.4 g/mol. IUPAC name: 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid. InChIKey: AJHRROUFKCHZHV-UHFFFAOYSA-N.
| Molecular formula | C20H19F2N5O3 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]pyridine-2-carboxylic acid |
| InChIKey | AJHRROUFKCHZHV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=C(C=C2)CN3CCN(CC3)C4=C(N=C(C=C4)C(=O)O)F)F)NC1=O |
Computed by PubChem (NCBI)