Products 2923861-57-6
CAS 2923861-57-6 is the registry number for tert-Butyl (R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2-carboxylate (CAS 2923861-57-6) is a chemical compound with the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2-carboxylate. InChIKey: LWGOBMLVDSSDMR-SECBINFHSA-N.
| Molecular formula | C12H23N3O2 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl (6R)-6-methyl-2,5,8-triazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | LWGOBMLVDSSDMR-SECBINFHSA-N |
| SMILES | C[C@@H]1CNCC2(N1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)