Products 2923867-92-7

CAS 2923867-92-7 is the registry number for Methyl 7-bromo-6-fluoro-1H-benzo[d][1,2,3]triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate (CAS 2923867-92-7) is a chemical compound with the molecular formula C8H5BrFN3O2 and a molecular weight of 274.05 g/mol. IUPAC name: methyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate. InChIKey: YUASCKAAYYAYTR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrFN3O2
Molecular weight274.05 g/mol
IUPAC namemethyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate
InChIKeyYUASCKAAYYAYTR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C2=NNN=C12)Br)F

Computed by PubChem (NCBI)