CAS 2923867-92-7 is the registry number for Methyl 7-bromo-6-fluoro-1H-benzo[d][1,2,3]triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate (CAS 2923867-92-7) is a chemical compound with the molecular formula C8H5BrFN3O2 and a molecular weight of 274.05 g/mol. IUPAC name: methyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate. InChIKey: YUASCKAAYYAYTR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN3O2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | methyl 7-bromo-6-fluoro-2H-benzotriazole-4-carboxylate |
| InChIKey | YUASCKAAYYAYTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C2=NNN=C12)Br)F |
Computed by PubChem (NCBI)