Products 2923980-60-1
CAS 2923980-60-1 is the registry number for 1,5,6,7,8,9-Hexahydro-2H-5,8-epiminocyclohepta[b]pyrazin-2-one hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one;hydrobromide (CAS 2923980-60-1) is a chemical compound with the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. IUPAC name: 3,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one;hydrobromide. InChIKey: JORZLLWIEGRUHN-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3O |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 3,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one;hydrobromide |
| InChIKey | JORZLLWIEGRUHN-UHFFFAOYSA-N |
| SMILES | C1CC2C3=C(CC1N2)NC(=O)C=N3.Br |
Computed by PubChem (NCBI)