CAS 2924-30-3 is the registry number for 2,4-Dibromo-3-fluoro-6-nitrophenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,4-dibromo-3-fluoro-6-nitrophenol (CAS 2924-30-3) is a chemical compound with the molecular formula C6H2Br2FNO3 and a molecular weight of 314.89 g/mol. IUPAC name: 2,4-dibromo-3-fluoro-6-nitrophenol. InChIKey: RXWWMSAGGZRKHF-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO3 |
|---|---|
| Molecular weight | 314.89 g/mol |
| IUPAC name | 2,4-dibromo-3-fluoro-6-nitrophenol |
| InChIKey | RXWWMSAGGZRKHF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)