Products 2924019-21-4
CAS 2924019-21-4 is the registry number for 5-Benzyl 2-(tert-butyl) (6R)-6,9-dimethyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-benzyl 2-O-tert-butyl (6R)-6,9-dimethyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2924019-21-4) is a chemical compound with the molecular formula C21H31N3O4 and a molecular weight of 389.5 g/mol. IUPAC name: 5-O-benzyl 2-O-tert-butyl (6R)-6,9-dimethyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: HUDGXQOESYLUKN-AAFJCEBUSA-N.
| Molecular formula | C21H31N3O4 |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | 5-O-benzyl 2-O-tert-butyl (6R)-6,9-dimethyl-2,5,8-triazaspiro[3.5]nonane-2,5-dicarboxylate |
| InChIKey | HUDGXQOESYLUKN-AAFJCEBUSA-N |
| SMILES | C[C@@H]1CNC(C2(N1C(=O)OCC3=CC=CC=C3)CN(C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)