Products 1251008-98-6

CAS 1251008-98-6 is the registry number for 1-Benzyl 9-tert-butyl 1,4,9-triazaspiro[5.5]undecane-1,9-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 9-O-tert-butyl 1,4,9-triazaspiro[5.5]undecane-1,9-dicarboxylate (CAS 1251008-98-6) is a chemical compound with the molecular formula C21H31N3O4 and a molecular weight of 389.5 g/mol. IUPAC name: 1-O-benzyl 9-O-tert-butyl 1,4,9-triazaspiro[5.5]undecane-1,9-dicarboxylate. InChIKey: ATDGPGLBEKGNMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H31N3O4
Molecular weight389.5 g/mol
IUPAC name1-O-benzyl 9-O-tert-butyl 1,4,9-triazaspiro[5.5]undecane-1,9-dicarboxylate
InChIKeyATDGPGLBEKGNMQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)CNCCN2C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)