Products 2924153-90-0

CAS 2924153-90-0 is the registry number for (E)-3-Methyl-5-(prop-1-en-1-yl)isothiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid (CAS 2924153-90-0) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid. InChIKey: PZCKULCOIZLWES-ONEGZZNKSA-N.

Identity
Molecular formulaC8H9NO2S
Molecular weight183.23 g/mol
IUPAC name3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid
InChIKeyPZCKULCOIZLWES-ONEGZZNKSA-N
SMILESC/C=C/C1=C(C(=NS1)C)C(=O)O

Computed by PubChem (NCBI)