CAS 2924153-90-0 is the registry number for (E)-3-Methyl-5-(prop-1-en-1-yl)isothiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid (CAS 2924153-90-0) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid. InChIKey: PZCKULCOIZLWES-ONEGZZNKSA-N.
| Molecular formula | C8H9NO2S |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | 3-methyl-5-[(E)-prop-1-enyl]-1,2-thiazole-4-carboxylic acid |
| InChIKey | PZCKULCOIZLWES-ONEGZZNKSA-N |
| SMILES | C/C=C/C1=C(C(=NS1)C)C(=O)O |
Computed by PubChem (NCBI)