Products 2924421-47-4
CAS 2924421-47-4 is the registry number for Methyl 2-methyl-7H-thieno[2',3':4,5]pyrrolo[3,2-d]thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-methyl-5,11-dithia-3,7-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,9-tetraene-10-carboxylate (CAS 2924421-47-4) is a chemical compound with the molecular formula C10H8N2O2S2 and a molecular weight of 252.3 g/mol. IUPAC name: methyl 4-methyl-5,11-dithia-3,7-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,9-tetraene-10-carboxylate. InChIKey: NBEKEWSDJKKALI-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S2 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | methyl 4-methyl-5,11-dithia-3,7-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,9-tetraene-10-carboxylate |
| InChIKey | NBEKEWSDJKKALI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)NC3=C2SC(=C3)C(=O)OC |
Computed by PubChem (NCBI)