CAS 64145-06-8 is the registry number for 2-((5-Phenyl-1,3,4-thiadiazol-2-yl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid (CAS 64145-06-8) is a chemical compound with the molecular formula C10H8N2O2S2 and a molecular weight of 252.3 g/mol. IUPAC name: 2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid. InChIKey: KASGLGRECIHPOP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S2 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid |
| InChIKey | KASGLGRECIHPOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)SCC(=O)O |
Computed by PubChem (NCBI)