CAS 2924486-45-1 appears in our catalog under these names: Rac1–IN–4, Rac1-IN-4, 98.61%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 50 mg, 5 mg, 1 g, 100 mg.
3-chloro-N-[3-[3-(5-methylfuran-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]phenyl]benzamide (CAS 2924486-45-1) is a chemical compound with the molecular formula C23H16ClN5O2 and a molecular weight of 429.9 g/mol. IUPAC name: 3-chloro-N-[3-[3-(5-methylfuran-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]phenyl]benzamide. InChIKey: DDIBTZNIAHHIIP-UHFFFAOYSA-N.
| Molecular formula | C23H16ClN5O2 |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | 3-chloro-N-[3-[3-(5-methylfuran-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]phenyl]benzamide |
| InChIKey | DDIBTZNIAHHIIP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=NN=C3N2N=C(C=C3)C4=CC(=CC=C4)NC(=O)C5=CC(=CC=C5)Cl |
Computed by PubChem (NCBI)