CAS 29245-44-1 appears in our catalog under these names: 5,5'-Dibromo-4,4'-dichloro-[2,2'-biindolinylidene]-3,3'-dione, 98%, Vat Blue 2, 75.0%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 100mg, 5mg, 10mg.
5-bromo-2-(5-bromo-4-chloro-3-hydroxy-1H-indol-2-yl)-4-chloroindol-3-one (CAS 29245-44-1) is a chemical compound with the molecular formula C16H6Br2Cl2N2O2 and a molecular weight of 488.9 g/mol. IUPAC name: 5-bromo-2-(5-bromo-4-chloro-3-hydroxy-1H-indol-2-yl)-4-chloroindol-3-one. InChIKey: DRLXAEQIVDKLNJ-UHFFFAOYSA-N.
| Molecular formula | C16H6Br2Cl2N2O2 |
|---|---|
| Molecular weight | 488.9 g/mol |
| IUPAC name | 5-bromo-2-(5-bromo-4-chloro-3-hydroxy-1H-indol-2-yl)-4-chloroindol-3-one |
| InChIKey | DRLXAEQIVDKLNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=C2O)C3=NC4=C(C3=O)C(=C(C=C4)Br)Cl)Cl)Br |
Computed by PubChem (NCBI)