Products 2924557-38-8
CAS 2924557-38-8 is the registry number for CDK8 ligand 1, 98.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
2-[4-(4-isoquinolin-4-ylphenyl)pyrazol-1-yl]-1-piperazin-1-ylethanone (CAS 2924557-38-8) is a chemical compound with the molecular formula C24H23N5O and a molecular weight of 397.5 g/mol. IUPAC name: 2-[4-(4-isoquinolin-4-ylphenyl)pyrazol-1-yl]-1-piperazin-1-ylethanone. InChIKey: SQZGEYUMOOLNPI-UHFFFAOYSA-N.
| Molecular formula | C24H23N5O |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 2-[4-(4-isoquinolin-4-ylphenyl)pyrazol-1-yl]-1-piperazin-1-ylethanone |
| InChIKey | SQZGEYUMOOLNPI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CN2C=C(C=N2)C3=CC=C(C=C3)C4=CN=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)