Products 2924651-13-6
CAS 2924651-13-6 is the registry number for Di-tert-butyl 3-oxo-2,6,9-triazaspiro[4.5]decane-6,9-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl 3-oxo-2,6,9-triazaspiro[4.5]decane-6,9-dicarboxylate (CAS 2924651-13-6) is a chemical compound with the molecular formula C17H29N3O5 and a molecular weight of 355.4 g/mol. IUPAC name: ditert-butyl 3-oxo-2,6,9-triazaspiro[4.5]decane-6,9-dicarboxylate. InChIKey: USOKBESHLKJJLD-UHFFFAOYSA-N.
| Molecular formula | C17H29N3O5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | ditert-butyl 3-oxo-2,6,9-triazaspiro[4.5]decane-6,9-dicarboxylate |
| InChIKey | USOKBESHLKJJLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2(C1)CC(=O)NC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)