Products 2924824-25-7
CAS 2924824-25-7 is the registry number for 3-(2,6-Dimethylmorpholino)-5-fluoroaniline hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline;hydrochloride (CAS 2924824-25-7) is a chemical compound with the molecular formula C12H18ClFN2O and a molecular weight of 260.73 g/mol. IUPAC name: 3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline;hydrochloride. InChIKey: GNTGKEWBRGWYPE-UHFFFAOYSA-N.
| Molecular formula | C12H18ClFN2O |
|---|---|
| Molecular weight | 260.73 g/mol |
| IUPAC name | 3-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline;hydrochloride |
| InChIKey | GNTGKEWBRGWYPE-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=CC(=CC(=C2)N)F.Cl |
Computed by PubChem (NCBI)