CAS 1909312-65-7 is the registry number for 3-Amino-2-((4-fluorophenyl)methyl)-N,N-dimethylpropanamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(aminomethyl)-3-(4-fluorophenyl)-N,N-dimethylpropanamide;hydrochloride (CAS 1909312-65-7) is a chemical compound with the molecular formula C12H18ClFN2O and a molecular weight of 260.73 g/mol. IUPAC name: 2-(aminomethyl)-3-(4-fluorophenyl)-N,N-dimethylpropanamide;hydrochloride. InChIKey: STKDYFNODKNTJY-UHFFFAOYSA-N.
| Molecular formula | C12H18ClFN2O |
|---|---|
| Molecular weight | 260.73 g/mol |
| IUPAC name | 2-(aminomethyl)-3-(4-fluorophenyl)-N,N-dimethylpropanamide;hydrochloride |
| InChIKey | STKDYFNODKNTJY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(CC1=CC=C(C=C1)F)CN.Cl |
Computed by PubChem (NCBI)