Products 2924824-34-8
CAS 2924824-34-8 appears in our catalog under these names: 3-Amino-N-cyclopropylcyclohexanecarboxamide hydrochloride, 95%, 3-Amino-N-cyclopropylcyclohexanecarboxamide hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
3-amino-N-cyclopropylcyclohexane-1-carboxamide;hydrochloride (CAS 2924824-34-8) is a chemical compound with the molecular formula C10H19ClN2O and a molecular weight of 218.72 g/mol. IUPAC name: 3-amino-N-cyclopropylcyclohexane-1-carboxamide;hydrochloride. InChIKey: FVLXNRDUVRQYLU-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O |
|---|---|
| Molecular weight | 218.72 g/mol |
| IUPAC name | 3-amino-N-cyclopropylcyclohexane-1-carboxamide;hydrochloride |
| InChIKey | FVLXNRDUVRQYLU-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)N)C(=O)NC2CC2.Cl |
Computed by PubChem (NCBI)