CAS 2680614-77-9 is the registry number for (3'R)-[1,3'-Bipiperidin]-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
1-[(3R)-piperidin-3-yl]piperidin-2-one;hydrochloride (CAS 2680614-77-9) is a chemical compound with the molecular formula C10H19ClN2O and a molecular weight of 218.72 g/mol. IUPAC name: 1-[(3R)-piperidin-3-yl]piperidin-2-one;hydrochloride. InChIKey: SSRAFPMCLJMCAU-SBSPUUFOSA-N.
| Molecular formula | C10H19ClN2O |
|---|---|
| Molecular weight | 218.72 g/mol |
| IUPAC name | 1-[(3R)-piperidin-3-yl]piperidin-2-one;hydrochloride |
| InChIKey | SSRAFPMCLJMCAU-SBSPUUFOSA-N |
| SMILES | C1CCN(C(=O)C1)[C@@H]2CCCNC2.Cl |
Computed by PubChem (NCBI)