Products 2925-42-0

CAS 2925-42-0 is the registry number for Acetaldehyde butyl 2,2,2-trifluoroethyl acetal, 95%. Offered by: Combi-blocks. Available pack sizes: 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

1-[1-(2,2,2-trifluoroethoxy)ethoxy]butane (CAS 2925-42-0) is a chemical compound with the molecular formula C8H15F3O2 and a molecular weight of 200.20 g/mol. IUPAC name: 1-[1-(2,2,2-trifluoroethoxy)ethoxy]butane. InChIKey: DIKMXGDAKSQQSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15F3O2
Molecular weight200.20 g/mol
IUPAC name1-[1-(2,2,2-trifluoroethoxy)ethoxy]butane
InChIKeyDIKMXGDAKSQQSJ-UHFFFAOYSA-N
SMILESCCCCOC(C)OCC(F)(F)F

Computed by PubChem (NCBI)