CAS 2925046-28-0 is the registry number for CM-728. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,10-dihydroxy-12-pyridin-3-yl-13H-naphtho[3,2-b][1,4]benzoxazepine-6,11-dione (CAS 2925046-28-0) is a chemical compound with the molecular formula C22H14N2O5 and a molecular weight of 386.4 g/mol. IUPAC name: 7,10-dihydroxy-12-pyridin-3-yl-13H-naphtho[3,2-b][1,4]benzoxazepine-6,11-dione. InChIKey: XJUMGECKQMPEPJ-UHFFFAOYSA-N.
| Molecular formula | C22H14N2O5 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 7,10-dihydroxy-12-pyridin-3-yl-13H-naphtho[3,2-b][1,4]benzoxazepine-6,11-dione |
| InChIKey | XJUMGECKQMPEPJ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2OC3=C(N1C4=CN=CC=C4)C(=O)C5=C(C=CC(=C5C3=O)O)O |
Computed by PubChem (NCBI)