CAS 2925068-49-9 appears in our catalog under these names: (3R,4S)-4-Fluoropiperidin-3-amine dihydrochloride, 95%, (3R,4S)-4-fluoropiperidin-3-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(3R,4S)-4-fluoropiperidin-3-amine;dihydrochloride (CAS 2925068-49-9) is a chemical compound with the molecular formula C5H13Cl2FN2 and a molecular weight of 191.07 g/mol. IUPAC name: (3R,4S)-4-fluoropiperidin-3-amine;dihydrochloride. InChIKey: GHIVXOFIOITYEP-YAQRUTEZSA-N.
| Molecular formula | C5H13Cl2FN2 |
|---|---|
| Molecular weight | 191.07 g/mol |
| IUPAC name | (3R,4S)-4-fluoropiperidin-3-amine;dihydrochloride |
| InChIKey | GHIVXOFIOITYEP-YAQRUTEZSA-N |
| SMILES | C1CNC[C@H]([C@H]1F)N.Cl.Cl |
Computed by PubChem (NCBI)