Products 2925308-76-3
CAS 2925308-76-3 is the registry number for DNA Gyrase-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3-amino-5-imino-4H-pyrazol-1-yl)-[2-(4-bromophenyl)quinolin-4-yl]methanone (CAS 2925308-76-3) is a chemical compound with the molecular formula C19H14BrN5O and a molecular weight of 408.3 g/mol. IUPAC name: (3-amino-5-imino-4H-pyrazol-1-yl)-[2-(4-bromophenyl)quinolin-4-yl]methanone. InChIKey: VXXKCKTXJWGCHT-UHFFFAOYSA-N.
| Molecular formula | C19H14BrN5O |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | (3-amino-5-imino-4H-pyrazol-1-yl)-[2-(4-bromophenyl)quinolin-4-yl]methanone |
| InChIKey | VXXKCKTXJWGCHT-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=N)C(=O)C2=CC(=NC3=CC=CC=C32)C4=CC=C(C=C4)Br)N |
Computed by PubChem (NCBI)
Synonyms:
DNA Gyrase-IN-8, orb2278462