Products 2925479-99-6
CAS 2925479-99-6 is the registry number for 2-(6,8-Difluoronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6,8-difluoronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2925479-99-6) is a chemical compound with the molecular formula C16H17BF2O2 and a molecular weight of 290.1 g/mol. IUPAC name: 2-(6,8-difluoronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZFYITSGSKQXMTB-UHFFFAOYSA-N.
| Molecular formula | C16H17BF2O2 |
|---|---|
| Molecular weight | 290.1 g/mol |
| IUPAC name | 2-(6,8-difluoronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZFYITSGSKQXMTB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(C=C3F)F |
Computed by PubChem (NCBI)