Products 2925597-58-4
CAS 2925597-58-4 is the registry number for N-((R)-1-(3-Cyano-2-methylphenyl)ethyl)-2-methylpropane-2-sulfinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1R)-1-(3-cyano-2-methylphenyl)ethyl]-2-methylpropane-2-sulfinamide (CAS 2925597-58-4) is a chemical compound with the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. IUPAC name: N-[(1R)-1-(3-cyano-2-methylphenyl)ethyl]-2-methylpropane-2-sulfinamide. InChIKey: WDEXCLBCLIARQK-SSJGJQFISA-N.
| Molecular formula | C14H20N2OS |
|---|---|
| Molecular weight | 264.39 g/mol |
| IUPAC name | N-[(1R)-1-(3-cyano-2-methylphenyl)ethyl]-2-methylpropane-2-sulfinamide |
| InChIKey | WDEXCLBCLIARQK-SSJGJQFISA-N |
| SMILES | CC1=C(C=CC=C1[C@@H](C)NS(=O)C(C)(C)C)C#N |
Computed by PubChem (NCBI)