CAS 2925691-90-1 is the registry number for 5,7-Dichloro-N,N-dimethylthiazolo[4,5-d]pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-N,N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine (CAS 2925691-90-1) is a chemical compound with the molecular formula C7H6Cl2N4S and a molecular weight of 249.12 g/mol. IUPAC name: 5,7-dichloro-N,N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine. InChIKey: PFINHPZCLCHTKM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4S |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | 5,7-dichloro-N,N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine |
| InChIKey | PFINHPZCLCHTKM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(S1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)