CAS 2925787-93-3 is the registry number for rel-(3R,5S)-3,5-Diaminotetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-1,1-dioxothiane-3,5-diamine (CAS 2925787-93-3) is a chemical compound with the molecular formula C5H12N2O2S and a molecular weight of 164.23 g/mol. IUPAC name: (3R,5S)-1,1-dioxothiane-3,5-diamine. InChIKey: KFMHDMISRXLTJO-SYDPRGILSA-N.
| Molecular formula | C5H12N2O2S |
|---|---|
| Molecular weight | 164.23 g/mol |
| IUPAC name | (3R,5S)-1,1-dioxothiane-3,5-diamine |
| InChIKey | KFMHDMISRXLTJO-SYDPRGILSA-N |
| SMILES | C1[C@H](CS(=O)(=O)C[C@H]1N)N |
Computed by PubChem (NCBI)