Products 2925926-80-1
CAS 2925926-80-1 is the registry number for Quorum sensing-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-fluoro-N-[[4-(4-fluorophenyl)-5-methylidene-2-oxofuran-3-yl]methyl]benzamide (CAS 2925926-80-1) is a chemical compound with the molecular formula C19H13F2NO3 and a molecular weight of 341.3 g/mol. IUPAC name: 4-fluoro-N-[[4-(4-fluorophenyl)-5-methylidene-2-oxofuran-3-yl]methyl]benzamide. InChIKey: NQPBBFRTQLYIMO-UHFFFAOYSA-N.
| Molecular formula | C19H13F2NO3 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 4-fluoro-N-[[4-(4-fluorophenyl)-5-methylidene-2-oxofuran-3-yl]methyl]benzamide |
| InChIKey | NQPBBFRTQLYIMO-UHFFFAOYSA-N |
| SMILES | C=C1C(=C(C(=O)O1)CNC(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
Quorum Sensing-IN-2, orb1944411