Products 2926692-82-0
CAS 2926692-82-0 is the registry number for 7-Bromo-1,2,3,4-tetrahydro-5H-thieno[2,3-e][1,4]diazepin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one (CAS 2926692-82-0) is a chemical compound with the molecular formula C7H7BrN2OS and a molecular weight of 247.11 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one. InChIKey: NDNMIHOPEORDIM-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2OS |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydrothieno[2,3-e][1,4]diazepin-5-one |
| InChIKey | NDNMIHOPEORDIM-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)SC(=C2)Br |
Computed by PubChem (NCBI)