CAS 29270-56-2 appears in our catalog under these names: 4-Fluoro-7-nitro-2,1,3-benzoxadiazole, >95% (HPLC), NBD-F/ 95.15% (existing batch purity), NBD–F (4–Fluoro–7–nitrobenzofurazan), 4-Fluoro-7-nitrobenzofurazan , NBD-F (=4-Fluoro-7-nitro-2,1,3-benzoxadiazole) [for HPLC Labeling], >99.0%(HPLC). Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 250mg, 25mg, 5mg, 50mg, 100mg, 1g, 5g, 10MG.
4-fluoro-7-nitro-2,1,3-benzoxadiazole (CAS 29270-56-2) is a chemical compound with the molecular formula C6H2FN3O3 and a molecular weight of 183.10 g/mol. IUPAC name: 4-fluoro-7-nitro-2,1,3-benzoxadiazole. InChIKey: PGZIDERTDJHJFY-UHFFFAOYSA-N.
| Molecular formula | C6H2FN3O3 |
|---|---|
| Molecular weight | 183.10 g/mol |
| IUPAC name | 4-fluoro-7-nitro-2,1,3-benzoxadiazole |
| InChIKey | PGZIDERTDJHJFY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)