Products 29271-33-8

CAS 29271-33-8 is the registry number for 3-((Trifluoromethyl)sulfanyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-(trifluoromethylsulfanyl)propanoic acid (CAS 29271-33-8) is a chemical compound with the molecular formula C4H5F3O2S and a molecular weight of 174.14 g/mol. IUPAC name: 3-(trifluoromethylsulfanyl)propanoic acid. InChIKey: OOVGGQBKEHHKGB-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5F3O2S
Molecular weight174.14 g/mol
IUPAC name3-(trifluoromethylsulfanyl)propanoic acid
InChIKeyOOVGGQBKEHHKGB-UHFFFAOYSA-N
SMILESC(CSC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)