Products 2927440-43-3
CAS 2927440-43-3 is the registry number for ((3S,5S)-3-Fluoro-1-azabicyclo[3.2.0]heptan-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,5S)-3-fluoro-1-azabicyclo[3.2.0]heptan-5-yl]methanol (CAS 2927440-43-3) is a chemical compound with the molecular formula C7H12FNO and a molecular weight of 145.17 g/mol. IUPAC name: [(3S,5S)-3-fluoro-1-azabicyclo[3.2.0]heptan-5-yl]methanol. InChIKey: PZJIDWSSKVFRRX-BQBZGAKWSA-N.
| Molecular formula | C7H12FNO |
|---|---|
| Molecular weight | 145.17 g/mol |
| IUPAC name | [(3S,5S)-3-fluoro-1-azabicyclo[3.2.0]heptan-5-yl]methanol |
| InChIKey | PZJIDWSSKVFRRX-BQBZGAKWSA-N |
| SMILES | C1CN2[C@@]1(C[C@@H](C2)F)CO |
Computed by PubChem (NCBI)