Products 2928606-67-9
CAS 2928606-67-9 is the registry number for Pim-1 kinase inhibitor 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-4-(2-chloroquinolin-3-yl)-6-(4-methoxyphenyl)pyridine-3-carbonitrile (CAS 2928606-67-9) is a chemical compound with the molecular formula C22H13Cl2N3O and a molecular weight of 406.3 g/mol. IUPAC name: 2-chloro-4-(2-chloroquinolin-3-yl)-6-(4-methoxyphenyl)pyridine-3-carbonitrile. InChIKey: JTCXKTJMNJNUGG-UHFFFAOYSA-N.
| Molecular formula | C22H13Cl2N3O |
|---|---|
| Molecular weight | 406.3 g/mol |
| IUPAC name | 2-chloro-4-(2-chloroquinolin-3-yl)-6-(4-methoxyphenyl)pyridine-3-carbonitrile |
| InChIKey | JTCXKTJMNJNUGG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C(C(=C2)C3=CC4=CC=CC=C4N=C3Cl)C#N)Cl |
Computed by PubChem (NCBI)
Synonyms:
Pim-1 kinase inhibitor 5, orb2278266