CAS 2928606-69-1 is the registry number for Pim-1 kinase inhibitor 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-bromophenyl)-2-chloro-4-(2-chloroquinolin-3-yl)pyridine-3-carbonitrile (CAS 2928606-69-1) is a chemical compound with the molecular formula C21H10BrCl2N3 and a molecular weight of 455.1 g/mol. IUPAC name: 6-(4-bromophenyl)-2-chloro-4-(2-chloroquinolin-3-yl)pyridine-3-carbonitrile. InChIKey: PJVIWFUJHRPIGU-UHFFFAOYSA-N.
| Molecular formula | C21H10BrCl2N3 |
|---|---|
| Molecular weight | 455.1 g/mol |
| IUPAC name | 6-(4-bromophenyl)-2-chloro-4-(2-chloroquinolin-3-yl)pyridine-3-carbonitrile |
| InChIKey | PJVIWFUJHRPIGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)Cl)C3=CC(=NC(=C3C#N)Cl)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)