Products 29288-18-4
CAS 29288-18-4 is the registry number for Rel-(2R,5R)-1,2,5-trimethylpiperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-1,2,5-trimethylpiperidin-4-one (CAS 29288-18-4) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (2R,5R)-1,2,5-trimethylpiperidin-4-one. InChIKey: VQHHMWWQNKUPKH-RNFRBKRXSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (2R,5R)-1,2,5-trimethylpiperidin-4-one |
| InChIKey | VQHHMWWQNKUPKH-RNFRBKRXSA-N |
| SMILES | C[C@@H]1CC(=O)[C@@H](CN1C)C |
Computed by PubChem (NCBI)