Products 2929308-79-0
CAS 2929308-79-0 appears in our catalog under these names: MY–1B, MY-1B, 99.94%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 100 mg, 10 mg, 50 mg, 25 mg, 5 mg.
(2R,3S)-3-(4-bromophenyl)-1-prop-2-enoyl-N-quinolin-8-ylazetidine-2-carboxamide (CAS 2929308-79-0) is a chemical compound with the molecular formula C22H18BrN3O2 and a molecular weight of 436.3 g/mol. IUPAC name: (2R,3S)-3-(4-bromophenyl)-1-prop-2-enoyl-N-quinolin-8-ylazetidine-2-carboxamide. InChIKey: DXMLBCROCLGUDK-DYESRHJHSA-N.
| Molecular formula | C22H18BrN3O2 |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | (2R,3S)-3-(4-bromophenyl)-1-prop-2-enoyl-N-quinolin-8-ylazetidine-2-carboxamide |
| InChIKey | DXMLBCROCLGUDK-DYESRHJHSA-N |
| SMILES | C=CC(=O)N1C[C@@H]([C@@H]1C(=O)NC2=CC=CC3=C2N=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)