CAS 2930-37-2 is the registry number for 2,4,6-Triphenylthiopyrylium Perchlorate. Offered by: TRC. Available pack sizes: 1g.
2,4,6-triphenylthiopyrylium perchlorate (CAS 2930-37-2) is a chemical compound with the molecular formula C23H17ClO4S and a molecular weight of 424.9 g/mol. IUPAC name: 2,4,6-triphenylthiopyrylium perchlorate. InChIKey: UAMORFUEIWNPCP-UHFFFAOYSA-M.
| Molecular formula | C23H17ClO4S |
|---|---|
| Molecular weight | 424.9 g/mol |
| IUPAC name | 2,4,6-triphenylthiopyrylium perchlorate |
| InChIKey | UAMORFUEIWNPCP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC(=[S+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)