CAS 2930564-26-2 appears in our catalog under these names: L–690330 hydrate, L-690330 (hydrate), 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mM (in 1ml dmso), 5mg, 5 mg, 10 mg, 10mM/1mL.
[1-(4-hydroxyphenoxy)-1-phosphonoethyl]phosphonic acid;hydrate (CAS 2930564-26-2) is a chemical compound with the molecular formula C8H14O9P2 and a molecular weight of 316.14 g/mol. IUPAC name: [1-(4-hydroxyphenoxy)-1-phosphonoethyl]phosphonic acid;hydrate. InChIKey: DKBBMFQPTDFCIO-UHFFFAOYSA-N.
| Molecular formula | C8H14O9P2 |
|---|---|
| Molecular weight | 316.14 g/mol |
| IUPAC name | [1-(4-hydroxyphenoxy)-1-phosphonoethyl]phosphonic acid;hydrate |
| InChIKey | DKBBMFQPTDFCIO-UHFFFAOYSA-N |
| SMILES | CC(OC1=CC=C(C=C1)O)(P(=O)(O)O)P(=O)(O)O.O |
Computed by PubChem (NCBI)