CAS 2930725-03-2 is the registry number for rel-(1R,2R,4S,6S)-6-Aminobicyclo[2.2.1]heptan-2-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,4S,6S)-6-aminobicyclo[2.2.1]heptan-2-ol;hydrochloride (CAS 2930725-03-2) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1R,2R,4S,6S)-6-aminobicyclo[2.2.1]heptan-2-ol;hydrochloride. InChIKey: FRJIWAJUVNFNCT-DABREVLYSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1R,2R,4S,6S)-6-aminobicyclo[2.2.1]heptan-2-ol;hydrochloride |
| InChIKey | FRJIWAJUVNFNCT-DABREVLYSA-N |
| SMILES | C1[C@H]2C[C@@H]([C@@H]1[C@@H](C2)O)N.Cl |
Computed by PubChem (NCBI)