CAS 2930725-14-5 is the registry number for rel-(1R,5S,6R)-2,2-Difluorobicyclo[3.1.0]hexan-6-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S,6R)-2,2-difluorobicyclo[3.1.0]hexan-6-amine;hydrochloride (CAS 2930725-14-5) is a chemical compound with the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. IUPAC name: (1R,5S,6R)-2,2-difluorobicyclo[3.1.0]hexan-6-amine;hydrochloride. InChIKey: PLEFYFCBMNLBRA-UJPDDDSFSA-N.
| Molecular formula | C6H10ClF2N |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | (1R,5S,6R)-2,2-difluorobicyclo[3.1.0]hexan-6-amine;hydrochloride |
| InChIKey | PLEFYFCBMNLBRA-UJPDDDSFSA-N |
| SMILES | C1CC([C@@H]2[C@H]1[C@H]2N)(F)F.Cl |
Computed by PubChem (NCBI)