CAS 2930832-09-8 appears in our catalog under these names: (3,5,7-Trifluoroadamantan-1-yl)methanamine hydrochloride, 97%, 97%, (3,5,7-Trifluoroadamantan-1-yl)methanamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(3,5,7-trifluoro-1-adamantyl)methanamine;hydrochloride (CAS 2930832-09-8) is a chemical compound with the molecular formula C11H17ClF3N and a molecular weight of 255.71 g/mol. IUPAC name: (3,5,7-trifluoro-1-adamantyl)methanamine;hydrochloride. InChIKey: ARICZRAOIYWEHU-UHFFFAOYSA-N.
| Molecular formula | C11H17ClF3N |
|---|---|
| Molecular weight | 255.71 g/mol |
| IUPAC name | (3,5,7-trifluoro-1-adamantyl)methanamine;hydrochloride |
| InChIKey | ARICZRAOIYWEHU-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)F)F)F)CN.Cl |
Computed by PubChem (NCBI)