Products 2930865-38-4
CAS 2930865-38-4 is the registry number for Ethyl 4-(4-(trifluoromethoxy)phenyl)-1H-benzo[d]imidazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-[4-(trifluoromethoxy)phenyl]-3H-benzimidazole-5-carboxylate (CAS 2930865-38-4) is a chemical compound with the molecular formula C17H13F3N2O3 and a molecular weight of 350.29 g/mol. IUPAC name: ethyl 7-[4-(trifluoromethoxy)phenyl]-3H-benzimidazole-5-carboxylate. InChIKey: CQTVPENVEWKOAW-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N2O3 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | ethyl 7-[4-(trifluoromethoxy)phenyl]-3H-benzimidazole-5-carboxylate |
| InChIKey | CQTVPENVEWKOAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2C(=C1)NC=N2)C3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)