CAS 2931-08-0 appears in our catalog under these names: Prephenic Acid Barium Salt (Mixture of Diastereomers), Prephenic acid barium salt. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 10mg, 25mg, 50mg.
Barium(2+);1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate (CAS 2931-08-0) is a chemical compound with the molecular formula C10H8BaO6 and a molecular weight of 361.49 g/mol. IUPAC name: barium(2+);1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate. InChIKey: XXHDQWSGCJPALI-UHFFFAOYSA-L.
| Molecular formula | C10H8BaO6 |
|---|---|
| Molecular weight | 361.49 g/mol |
| IUPAC name | barium(2+);1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate |
| InChIKey | XXHDQWSGCJPALI-UHFFFAOYSA-L |
| SMILES | C1=CC(C=CC1O)(CC(=O)C(=O)[O-])C(=O)[O-].[Ba+2] |
Computed by PubChem (NCBI)