CAS 293311-01-0 is the registry number for 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium (CAS 293311-01-0) is a chemical compound with the molecular formula C10H17N4O3+ and a molecular weight of 241.27 g/mol. IUPAC name: 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium. InChIKey: NZBKIOJQXNGENQ-UHFFFAOYSA-N.
| Molecular formula | C10H17N4O3+ |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium |
| InChIKey | NZBKIOJQXNGENQ-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCOCC1)C2=NC(=NC(=N2)OC)OC |
Computed by PubChem (NCBI)