CAS 29347-15-7 is the registry number for (3AR,8aS)-1,3a,8-Trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol (CAS 29347-15-7) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: (3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol. InChIKey: HKGWQUVGHPDEBZ-QWHCGFSZSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol |
| InChIKey | HKGWQUVGHPDEBZ-QWHCGFSZSA-N |
| SMILES | C[C@]12CCN([C@H]1N(C3=C2C=C(C=C3)O)C)C |
Computed by PubChem (NCBI)