CAS 2935429-79-9 is the registry number for (3R,4R)-3-(((tert-Butyldiphenylsilyl)oxy)methyl)-4-fluoropyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl-[[(3R,4R)-4-fluoropyrrolidin-3-yl]methoxy]-diphenylsilane (CAS 2935429-79-9) is a chemical compound with the molecular formula C21H28FNOSi and a molecular weight of 357.5 g/mol. IUPAC name: tert-butyl-[[(3R,4R)-4-fluoropyrrolidin-3-yl]methoxy]-diphenylsilane. InChIKey: ZEKDVZCFZGUDBK-XLIONFOSSA-N.
| Molecular formula | C21H28FNOSi |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | tert-butyl-[[(3R,4R)-4-fluoropyrrolidin-3-yl]methoxy]-diphenylsilane |
| InChIKey | ZEKDVZCFZGUDBK-XLIONFOSSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC[C@H]3CNC[C@@H]3F |
Computed by PubChem (NCBI)