CAS 2936672-01-2 is the registry number for (S)-5,6-Dihydro-4H-dispiro[benzo[c]isoxazole-7,1'-cyclohexane-2',2''-[1,3]dioxolane]-3-carboximidamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
CAS 2936672-01-2 identifies a chemical compound with the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. InChIKey: IJJMYHQGFFRJHI-AWEZNQCLSA-N.
| Molecular formula | C15H21N3O3 |
|---|---|
| Molecular weight | 291.35 g/mol |
| InChIKey | IJJMYHQGFFRJHI-AWEZNQCLSA-N |
| SMILES | C1CCC2([C@@]3(C1)CCCC4=C(ON=C34)C(=N)N)OCCO2 |
Computed by PubChem (NCBI)