CAS 2937046-84-7 is the registry number for (S)-Thalidomide-piperazin (besylate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzenesulfonic acid;2-[(3S)-2,6-dioxopiperidin-3-yl]-5-piperazin-1-ylisoindole-1,3-dione (CAS 2937046-84-7) is a chemical compound with the molecular formula C23H24N4O7S and a molecular weight of 500.5 g/mol. IUPAC name: benzenesulfonic acid;2-[(3S)-2,6-dioxopiperidin-3-yl]-5-piperazin-1-ylisoindole-1,3-dione. InChIKey: GFRPXIMYSOTUTK-ZOWNYOTGSA-N.
| Molecular formula | C23H24N4O7S |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | benzenesulfonic acid;2-[(3S)-2,6-dioxopiperidin-3-yl]-5-piperazin-1-ylisoindole-1,3-dione |
| InChIKey | GFRPXIMYSOTUTK-ZOWNYOTGSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCNCC4.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)