Products 293754-32-2
CAS 293754-32-2 is the registry number for NR1H3 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methylpropyl N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methylcarbamate (CAS 293754-32-2) is a chemical compound with the molecular formula C15H17F6NO3 and a molecular weight of 373.29 g/mol. IUPAC name: 2-methylpropyl N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methylcarbamate. InChIKey: BLPZFTZQFOPPGU-UHFFFAOYSA-N.
| Molecular formula | C15H17F6NO3 |
|---|---|
| Molecular weight | 373.29 g/mol |
| IUPAC name | 2-methylpropyl N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methylcarbamate |
| InChIKey | BLPZFTZQFOPPGU-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)N(C)C1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)